C17H19BrFNO — CID 63501140
N-[[3-[(4-bromo-2-fluorophenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 63501140) has the molecular formula C17H19BrFNO and a molecular weight of 352.25 g/mol. Its IUPAC name is N-[[3-[(4-bromo-2-fluorophenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(4-bromo-2-fluorophenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63501140 |
| Molecular Formula | C17H19BrFNO |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[[3-[(4-bromo-2-fluorophenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(OCc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C17H19BrFNO/c1-2-8-20-11-13-4-3-5-16(9-13)21-12-14-6-7-15(18)10-17(14)19/h3-7,9-10,20H,2,8,11-12H2,1H3 |
| InChIKey | NVSMLTPVMYUGAZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|