C18H32N2 — CID 63502856
N'-benzyl-N'-ethyl-N-heptan-2-ylethane-1,2-diamine (PubChem CID 63502856) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-N-heptan-2-ylethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-ethyl-N-heptan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63502856 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N'-benzyl-N'-ethyl-N-heptan-2-ylethane-1,2-diamine |
| SMILES | CCCCCC(C)NCCN(CC)Cc1ccccc1 |
| InChI | InChI=1S/C18H32N2/c1-4-6-8-11-17(3)19-14-15-20(5-2)16-18-12-9-7-10-13-18/h7,9-10,12-13,17,19H,4-6,8,11,14-16H2,1-3H3 |
| InChIKey | FNQKRSIKECMBSY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|