C18H38N2 — CID 63503790
N-[2-(4,4-diethylpiperidin-1-yl)ethyl]heptan-2-amine (PubChem CID 63503790) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is N-[2-(4,4-diethylpiperidin-1-yl)ethyl]heptan-2-amine.
| Compound Name | N-[2-(4,4-diethylpiperidin-1-yl)ethyl]heptan-2-amine |
|---|---|
| PubChem CID | 63503790 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N-[2-(4,4-diethylpiperidin-1-yl)ethyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCCN1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C18H38N2/c1-5-8-9-10-17(4)19-13-16-20-14-11-18(6-2,7-3)12-15-20/h17,19H,5-16H2,1-4H3 |
| InChIKey | TYJPUESZOBCMMB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|