C17H15Cl2NO — CID 63506552
(2,5-dichlorophenyl)-(2-ethyl-1-benzofuran-3-yl)methanamine (PubChem CID 63506552) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(2-ethyl-1-benzofuran-3-yl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(2-ethyl-1-benzofuran-3-yl)methanamine |
|---|---|
| PubChem CID | 63506552 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (2,5-dichlorophenyl)-(2-ethyl-1-benzofuran-3-yl)methanamine |
| SMILES | CCc1oc2ccccc2c1C(N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl2NO/c1-2-14-16(11-5-3-4-6-15(11)21-14)17(20)12-9-10(18)7-8-13(12)19/h3-9,17H,2,20H2,1H3 |
| InChIKey | HHOINEOTKHNYCT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |