C18H26N2 — CID 63506793
4-methyl-N-[2-(6-methylindol-1-yl)ethyl]cyclohexan-1-amine (PubChem CID 63506793) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-methyl-N-[2-(6-methylindol-1-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-methyl-N-[2-(6-methylindol-1-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 63506793 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-methyl-N-[2-(6-methylindol-1-yl)ethyl]cyclohexan-1-amine |
| SMILES | Cc1ccc2ccn(CCNC3CCC(C)CC3)c2c1 |
| InChI | InChI=1S/C18H26N2/c1-14-4-7-17(8-5-14)19-10-12-20-11-9-16-6-3-15(2)13-18(16)20/h3,6,9,11,13-14,17,19H,4-5,7-8,10,12H2,1-2H3 |
| InChIKey | ZEHOKRPDMHZMBC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |