C14H14Br3NOS — CID 63506848
N-[(5-methylthiophen-2-yl)methyl]-2-(2,4,6-tribromophenoxy)ethanamine (PubChem CID 63506848) has the molecular formula C14H14Br3NOS and a molecular weight of 484.05 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-2-(2,4,6-tribromophenoxy)ethanamine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-2-(2,4,6-tribromophenoxy)ethanamine |
|---|---|
| PubChem CID | 63506848 |
| Molecular Formula | C14H14Br3NOS |
| Molecular Weight | 484.05 g/mol |
| Exact Mass | 480.83 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-2-(2,4,6-tribromophenoxy)ethanamine |
| SMILES | Cc1ccc(CNCCOc2c(Br)cc(Br)cc2Br)s1 |
| InChI | InChI=1S/C14H14Br3NOS/c1-9-2-3-11(20-9)8-18-4-5-19-14-12(16)6-10(15)7-13(14)17/h2-3,6-7,18H,4-5,8H2,1H3 |
| InChIKey | HKHPVWHPBOQZDT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.05 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|