C18H21ClFN — CID 63508129
2-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-2-phenylbutan-1-amine (PubChem CID 63508129) has the molecular formula C18H21ClFN and a molecular weight of 305.82 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-2-phenylbutan-1-amine.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-2-phenylbutan-1-amine |
|---|---|
| PubChem CID | 63508129 |
| Molecular Formula | C18H21ClFN |
| Molecular Weight | 305.82 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-2-phenylbutan-1-amine |
| SMILES | CCC(CNC)(Cc1ccc(F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H21ClFN/c1-3-18(13-21-2,15-7-5-4-6-8-15)12-14-9-10-16(20)11-17(14)19/h4-11,21H,3,12-13H2,1-2H3 |
| InChIKey | XUKKBZUNYQXNHH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |