C17H18Cl2O — CID 66058930
2-[(2,5-dichlorophenyl)methyl]-2-phenylbutan-1-ol (PubChem CID 66058930) has the molecular formula C17H18Cl2O and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl]-2-phenylbutan-1-ol.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl]-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 66058930 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl]-2-phenylbutan-1-ol |
| SMILES | CCC(CO)(Cc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H18Cl2O/c1-2-17(12-20,14-6-4-3-5-7-14)11-13-10-15(18)8-9-16(13)19/h3-10,20H,2,11-12H2,1H3 |
| InChIKey | ULNFQTSYLXTLBL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |