C16H13Br3Cl2 — CID 79443813
2-[3-bromo-2-(bromomethyl)-2-(4-bromophenyl)propyl]-1,4-dichlorobenzene (PubChem CID 79443813) has the molecular formula C16H13Br3Cl2 and a molecular weight of 515.90 g/mol. Its IUPAC name is 2-[3-bromo-2-(bromomethyl)-2-(4-bromophenyl)propyl]-1,4-dichlorobenzene.
| Compound Name | 2-[3-bromo-2-(bromomethyl)-2-(4-bromophenyl)propyl]-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 79443813 |
| Molecular Formula | C16H13Br3Cl2 |
| Molecular Weight | 515.90 g/mol |
| Exact Mass | 511.79 |
| IUPAC Name | 2-[3-bromo-2-(bromomethyl)-2-(4-bromophenyl)propyl]-1,4-dichlorobenzene |
| SMILES | Clc1ccc(Cl)c(CC(CBr)(CBr)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H13Br3Cl2/c17-9-16(10-18,12-1-3-13(19)4-2-12)8-11-7-14(20)5-6-15(11)21/h1-7H,8-10H2 |
| InChIKey | VZHFBROMHZFZSI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|