C11H13BrCl2 — CID 66048184
2-(3-bromo-2,2-dimethylpropyl)-1,4-dichlorobenzene (PubChem CID 66048184) has the molecular formula C11H13BrCl2 and a molecular weight of 296.03 g/mol. Its IUPAC name is 2-(3-bromo-2,2-dimethylpropyl)-1,4-dichlorobenzene.
| Compound Name | 2-(3-bromo-2,2-dimethylpropyl)-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 66048184 |
| Molecular Formula | C11H13BrCl2 |
| Molecular Weight | 296.03 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 2-(3-bromo-2,2-dimethylpropyl)-1,4-dichlorobenzene |
| SMILES | CC(C)(CBr)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13BrCl2/c1-11(2,7-12)6-8-5-9(13)3-4-10(8)14/h3-5H,6-7H2,1-2H3 |
| InChIKey | OMCPGWLUDZRYIN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|