C15H21ClN2 — CID 63510817
3-chloro-4-(2,4,4-trimethylpentan-2-ylamino)benzonitrile (PubChem CID 63510817) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 3-chloro-4-(2,4,4-trimethylpentan-2-ylamino)benzonitrile.
| Compound Name | 3-chloro-4-(2,4,4-trimethylpentan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 63510817 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-chloro-4-(2,4,4-trimethylpentan-2-ylamino)benzonitrile |
| SMILES | CC(C)(C)CC(C)(C)Nc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C15H21ClN2/c1-14(2,3)10-15(4,5)18-13-7-6-11(9-17)8-12(13)16/h6-8,18H,10H2,1-5H3 |
| InChIKey | UIDHDGXEVAHAPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |