C17H31N3S — CID 63512877
7-N-ethyl-2-N,2-N-bis(2-methylpropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 63512877) has the molecular formula C17H31N3S and a molecular weight of 309.52 g/mol. Its IUPAC name is 7-N-ethyl-2-N,2-N-bis(2-methylpropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 7-N-ethyl-2-N,2-N-bis(2-methylpropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 63512877 |
| Molecular Formula | C17H31N3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 7-N-ethyl-2-N,2-N-bis(2-methylpropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCNC1CCCc2nc(N(CC(C)C)CC(C)C)sc21 |
| InChI | InChI=1S/C17H31N3S/c1-6-18-14-8-7-9-15-16(14)21-17(19-15)20(10-12(2)3)11-13(4)5/h12-14,18H,6-11H2,1-5H3 |
| InChIKey | LVFKYKCEIRWWDE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |