C14H20N4S2 — CID 62754763
7-N-ethyl-2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62754763) has the molecular formula C14H20N4S2 and a molecular weight of 308.48 g/mol. Its IUPAC name is 7-N-ethyl-2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 7-N-ethyl-2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62754763 |
| Molecular Formula | C14H20N4S2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 7-N-ethyl-2-N-methyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCNC1CCCc2nc(N(C)Cc3cscn3)sc21 |
| InChI | InChI=1S/C14H20N4S2/c1-3-15-11-5-4-6-12-13(11)20-14(17-12)18(2)7-10-8-19-9-16-10/h8-9,11,15H,3-7H2,1-2H3 |
| InChIKey | IYDZPKFHKOZQKY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |