C15H22N4S2 — CID 62754764
2-N-methyl-7-N-propyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62754764) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-N-methyl-7-N-propyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-methyl-7-N-propyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62754764 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-N-methyl-7-N-propyl-2-N-(1,3-thiazol-4-ylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCCNC1CCCc2nc(N(C)Cc3cscn3)sc21 |
| InChI | InChI=1S/C15H22N4S2/c1-3-7-16-12-5-4-6-13-14(12)21-15(18-13)19(2)8-11-9-20-10-17-11/h9-10,12,16H,3-8H2,1-2H3 |
| InChIKey | YXHCKRVOTCGMAK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |