C10H16N2S — CID 62078789
N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 62078789) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 62078789 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CCCNC1CCCc2ncsc21 |
| InChI | InChI=1S/C10H16N2S/c1-2-6-11-8-4-3-5-9-10(8)13-7-12-9/h7-8,11H,2-6H2,1H3 |
| InChIKey | GJXNECBRKGDIDE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |