C14H18BrN3S2 — CID 62752706
2-N-[(4-bromothiophen-2-yl)methyl]-2-N,7-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62752706) has the molecular formula C14H18BrN3S2 and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-N-[(4-bromothiophen-2-yl)methyl]-2-N,7-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-[(4-bromothiophen-2-yl)methyl]-2-N,7-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62752706 |
| Molecular Formula | C14H18BrN3S2 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2-N-[(4-bromothiophen-2-yl)methyl]-2-N,7-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CNC1CCCc2nc(N(C)Cc3cc(Br)cs3)sc21 |
| InChI | InChI=1S/C14H18BrN3S2/c1-16-11-4-3-5-12-13(11)20-14(17-12)18(2)7-10-6-9(15)8-19-10/h6,8,11,16H,3-5,7H2,1-2H3 |
| InChIKey | NCIVQSRUNRREMF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |