C17H22N2OS — CID 63513237
4-tert-butyl-2-[methyl-[(2-methylphenyl)methyl]amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 63513237) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-tert-butyl-2-[methyl-[(2-methylphenyl)methyl]amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-tert-butyl-2-[methyl-[(2-methylphenyl)methyl]amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63513237 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-tert-butyl-2-[methyl-[(2-methylphenyl)methyl]amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1ccccc1CN(C)c1nc(C(C)(C)C)c(C=O)s1 |
| InChI | InChI=1S/C17H22N2OS/c1-12-8-6-7-9-13(12)10-19(5)16-18-15(17(2,3)4)14(11-20)21-16/h6-9,11H,10H2,1-5H3 |
| InChIKey | OFNXWYVSDLIEAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|