C18H20FNO — CID 63515935
3-fluoro-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]aniline (PubChem CID 63515935) has the molecular formula C18H20FNO and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-fluoro-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]aniline.
| Compound Name | 3-fluoro-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]aniline |
|---|---|
| PubChem CID | 63515935 |
| Molecular Formula | C18H20FNO |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-fluoro-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]aniline |
| SMILES | Fc1cccc(NCCOc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C18H20FNO/c19-16-6-3-7-17(13-16)20-10-11-21-18-9-8-14-4-1-2-5-15(14)12-18/h3,6-9,12-13,20H,1-2,4-5,10-11H2 |
| InChIKey | UAEUMCTYHCMTOB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|