C13H24N4S — CID 63515997
N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-methylcyclohexan-1-amine (PubChem CID 63515997) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63515997 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-methylcyclohexan-1-amine |
| SMILES | Cc1nnc(SCCNC2CCCC(C)C2)n1C |
| InChI | InChI=1S/C13H24N4S/c1-10-5-4-6-12(9-10)14-7-8-18-13-16-15-11(2)17(13)3/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | TXRMYEOSRVUAHP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|