C17H22ClNO2 — CID 63517054
2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-N-(furan-3-ylmethyl)ethanamine (PubChem CID 63517054) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-N-(furan-3-ylmethyl)ethanamine.
| Compound Name | 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-N-(furan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 63517054 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(4-chloro-2-methyl-5-propan-2-ylphenoxy)-N-(furan-3-ylmethyl)ethanamine |
| SMILES | Cc1cc(Cl)c(C(C)C)cc1OCCNCc1ccoc1 |
| InChI | InChI=1S/C17H22ClNO2/c1-12(2)15-9-17(13(3)8-16(15)18)21-7-5-19-10-14-4-6-20-11-14/h4,6,8-9,11-12,19H,5,7,10H2,1-3H3 |
| InChIKey | WXPKFGIPIJQAHU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|