C12H8Cl3N3S — CID 63519381
4-(2,4,5-trichloroanilino)pyridine-2-carbothioamide (PubChem CID 63519381) has the molecular formula C12H8Cl3N3S and a molecular weight of 332.64 g/mol. Its IUPAC name is 4-(2,4,5-trichloroanilino)pyridine-2-carbothioamide.
| Compound Name | 4-(2,4,5-trichloroanilino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63519381 |
| Molecular Formula | C12H8Cl3N3S |
| Molecular Weight | 332.64 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 4-(2,4,5-trichloroanilino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(Nc2cc(Cl)c(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C12H8Cl3N3S/c13-7-4-9(15)10(5-8(7)14)18-6-1-2-17-11(3-6)12(16)19/h1-5H,(H2,16,19)(H,17,18) |
| InChIKey | MEWAYLOILGUDIA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|