C16H24BrNS — CID 63521459
N-[[2-[(4-bromothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-1-amine (PubChem CID 63521459) has the molecular formula C16H24BrNS and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[[2-[(4-bromothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(4-bromothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63521459 |
| Molecular Formula | C16H24BrNS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[[2-[(4-bromothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(Cc2cc(Br)cs2)CC2CCC1C2 |
| InChI | InChI=1S/C16H24BrNS/c1-2-5-18-11-16(8-12-3-4-13(16)6-12)9-15-7-14(17)10-19-15/h7,10,12-13,18H,2-6,8-9,11H2,1H3 |
| InChIKey | AHRLQNGATJLDKV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|