C18H30ClN — CID 63522996
2-[(3-chlorophenyl)methyl]-5-methyl-N-(2-methylpropyl)hexan-1-amine (PubChem CID 63522996) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-5-methyl-N-(2-methylpropyl)hexan-1-amine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-5-methyl-N-(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 63522996 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-5-methyl-N-(2-methylpropyl)hexan-1-amine |
| SMILES | CC(C)CCC(CNCC(C)C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H30ClN/c1-14(2)8-9-17(13-20-12-15(3)4)10-16-6-5-7-18(19)11-16/h5-7,11,14-15,17,20H,8-10,12-13H2,1-4H3 |
| InChIKey | DWOVQQAADSWIOU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |