C18H31N — CID 63523408
2-ethyl-2-[(2,4,6-trimethylphenyl)methyl]hexan-1-amine (PubChem CID 63523408) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-ethyl-2-[(2,4,6-trimethylphenyl)methyl]hexan-1-amine.
| Compound Name | 2-ethyl-2-[(2,4,6-trimethylphenyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 63523408 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-ethyl-2-[(2,4,6-trimethylphenyl)methyl]hexan-1-amine |
| SMILES | CCCCC(CC)(CN)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H31N/c1-6-8-9-18(7-2,13-19)12-17-15(4)10-14(3)11-16(17)5/h10-11H,6-9,12-13,19H2,1-5H3 |
| InChIKey | SCTAUEPCWFWDKM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |