C16H25Br — CID 66049138
2-[2-(bromomethyl)-2-methylpentyl]-1,3,5-trimethylbenzene (PubChem CID 66049138) has the molecular formula C16H25Br and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-methylpentyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[2-(bromomethyl)-2-methylpentyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 66049138 |
| Molecular Formula | C16H25Br |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[2-(bromomethyl)-2-methylpentyl]-1,3,5-trimethylbenzene |
| SMILES | CCCC(C)(CBr)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H25Br/c1-6-7-16(5,11-17)10-15-13(3)8-12(2)9-14(15)4/h8-9H,6-7,10-11H2,1-5H3 |
| InChIKey | HZKMSFSDNTYOIA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|