C17H16FNO2 — CID 63528516
3-fluoro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid (PubChem CID 63528516) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 3-fluoro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid.
| Compound Name | 3-fluoro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 63528516 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-fluoro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
| SMILES | CC1CCc2ccccc2N1c1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C17H16FNO2/c1-11-9-10-12-5-2-3-8-15(12)19(11)16-13(17(20)21)6-4-7-14(16)18/h2-8,11H,9-10H2,1H3,(H,20,21) |
| InChIKey | UEFSVKVZGISBAE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |