C16H16Br2O — CID 63534399
1-[[2-bromo-4-(bromomethyl)phenoxy]methyl]-3,5-dimethylbenzene (PubChem CID 63534399) has the molecular formula C16H16Br2O and a molecular weight of 384.11 g/mol. Its IUPAC name is 1-[[2-bromo-4-(bromomethyl)phenoxy]methyl]-3,5-dimethylbenzene.
| Compound Name | 1-[[2-bromo-4-(bromomethyl)phenoxy]methyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 63534399 |
| Molecular Formula | C16H16Br2O |
| Molecular Weight | 384.11 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 1-[[2-bromo-4-(bromomethyl)phenoxy]methyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(COc2ccc(CBr)cc2Br)c1 |
| InChI | InChI=1S/C16H16Br2O/c1-11-5-12(2)7-14(6-11)10-19-16-4-3-13(9-17)8-15(16)18/h3-8H,9-10H2,1-2H3 |
| InChIKey | JIEDIACYZXHGTC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|