C17H18ClNO2 — CID 63542458
2-[1-chloro-2-(4-nitrophenyl)ethyl]-1,3,5-trimethylbenzene (PubChem CID 63542458) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-[1-chloro-2-(4-nitrophenyl)ethyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[1-chloro-2-(4-nitrophenyl)ethyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 63542458 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[1-chloro-2-(4-nitrophenyl)ethyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(Cl)Cc2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C17H18ClNO2/c1-11-8-12(2)17(13(3)9-11)16(18)10-14-4-6-15(7-5-14)19(20)21/h4-9,16H,10H2,1-3H3 |
| InChIKey | ITOXNNZWCZGTOA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|