C19H19ClO — CID 63542686
2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-5-methyl-1-benzofuran (PubChem CID 63542686) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-5-methyl-1-benzofuran.
| Compound Name | 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-5-methyl-1-benzofuran |
|---|---|
| PubChem CID | 63542686 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-5-methyl-1-benzofuran |
| SMILES | Cc1ccc(C)c(CC(Cl)c2cc3cc(C)ccc3o2)c1 |
| InChI | InChI=1S/C19H19ClO/c1-12-4-6-14(3)15(8-12)10-17(20)19-11-16-9-13(2)5-7-18(16)21-19/h4-9,11,17H,10H2,1-3H3 |
| InChIKey | KIVXYMHEQWSHPG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|