C13H18BrCl — CID 63543129
1-(2-bromo-4,4-dimethylpentyl)-4-chlorobenzene (PubChem CID 63543129) has the molecular formula C13H18BrCl and a molecular weight of 289.64 g/mol. Its IUPAC name is 1-(2-bromo-4,4-dimethylpentyl)-4-chlorobenzene.
| Compound Name | 1-(2-bromo-4,4-dimethylpentyl)-4-chlorobenzene |
|---|---|
| PubChem CID | 63543129 |
| Molecular Formula | C13H18BrCl |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(2-bromo-4,4-dimethylpentyl)-4-chlorobenzene |
| SMILES | CC(C)(C)CC(Br)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18BrCl/c1-13(2,3)9-11(14)8-10-4-6-12(15)7-5-10/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | SMJSOPBEYQTHEA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|