C12H18ClN — CID 43184844
1-(4-chlorophenyl)-3,3-dimethylbutan-1-amine (PubChem CID 43184844) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 43184844 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)CC(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClN/c1-12(2,3)8-11(14)9-4-6-10(13)7-5-9/h4-7,11H,8,14H2,1-3H3 |
| InChIKey | OOXVXVVHOKQXIZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |