C16H27N — CID 43103849
1-(4-butan-2-ylphenyl)-3,3-dimethylbutan-1-amine (PubChem CID 43103849) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(4-butan-2-ylphenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 43103849 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-3,3-dimethylbutan-1-amine |
| SMILES | CCC(C)c1ccc(C(N)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27N/c1-6-12(2)13-7-9-14(10-8-13)15(17)11-16(3,4)5/h7-10,12,15H,6,11,17H2,1-5H3 |
| InChIKey | QNWJQWKHWFGWPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |