C17H14ClFN2 — CID 63544847
2-(chloromethyl)-1-(2,3-dihydro-1H-inden-5-yl)-6-fluorobenzimidazole (PubChem CID 63544847) has the molecular formula C17H14ClFN2 and a molecular weight of 300.76 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,3-dihydro-1H-inden-5-yl)-6-fluorobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2,3-dihydro-1H-inden-5-yl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 63544847 |
| Molecular Formula | C17H14ClFN2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(chloromethyl)-1-(2,3-dihydro-1H-inden-5-yl)-6-fluorobenzimidazole |
| SMILES | Fc1ccc2nc(CCl)n(-c3ccc4c(c3)CCC4)c2c1 |
| InChI | InChI=1S/C17H14ClFN2/c18-10-17-20-15-7-5-13(19)9-16(15)21(17)14-6-4-11-2-1-3-12(11)8-14/h4-9H,1-3,10H2 |
| InChIKey | KPKTZPSIQRORLW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|