C15H10Cl3FN2 — CID 63546455
2-(2-chloroethyl)-1-(3,4-dichlorophenyl)-6-fluorobenzimidazole (PubChem CID 63546455) has the molecular formula C15H10Cl3FN2 and a molecular weight of 343.62 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3,4-dichlorophenyl)-6-fluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(3,4-dichlorophenyl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 63546455 |
| Molecular Formula | C15H10Cl3FN2 |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3,4-dichlorophenyl)-6-fluorobenzimidazole |
| SMILES | Fc1ccc2nc(CCCl)n(-c3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C15H10Cl3FN2/c16-6-5-15-20-13-4-1-9(19)7-14(13)21(15)10-2-3-11(17)12(18)8-10/h1-4,7-8H,5-6H2 |
| InChIKey | NFKDPCJDIXPDPS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|