C17H15BrN2S — CID 63548682
3-[1-(4-bromophenyl)ethyl]-4-phenyl-1H-imidazole-2-thione (PubChem CID 63548682) has the molecular formula C17H15BrN2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-[1-(4-bromophenyl)ethyl]-4-phenyl-1H-imidazole-2-thione.
| Compound Name | 3-[1-(4-bromophenyl)ethyl]-4-phenyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 63548682 |
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 3-[1-(4-bromophenyl)ethyl]-4-phenyl-1H-imidazole-2-thione |
| SMILES | CC(c1ccc(Br)cc1)n1c(-c2ccccc2)c[nH]c1=S |
| InChI | InChI=1S/C17H15BrN2S/c1-12(13-7-9-15(18)10-8-13)20-16(11-19-17(20)21)14-5-3-2-4-6-14/h2-12H,1H3,(H,19,21) |
| InChIKey | IRMHIBLTSPKZEY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|