C11H11BrN2S — CID 122188610
4-(4-bromophenyl)-6-methyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 122188610) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-methyl-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 4-(4-bromophenyl)-6-methyl-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 122188610 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 4-(4-bromophenyl)-6-methyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=CC(c2ccc(Br)cc2)NC(=S)N1 |
| InChI | InChI=1S/C11H11BrN2S/c1-7-6-10(14-11(15)13-7)8-2-4-9(12)5-3-8/h2-6,10H,1H3,(H2,13,14,15) |
| InChIKey | NFMUSUKZPDBIMA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|