C11H12N2S — CID 2850154
6-methyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 2850154) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 6-methyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 2850154 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-methyl-4-phenyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=CC(c2ccccc2)NC(=S)N1 |
| InChI | InChI=1S/C11H12N2S/c1-8-7-10(13-11(14)12-8)9-5-3-2-4-6-9/h2-7,10H,1H3,(H2,12,13,14) |
| InChIKey | KHCZLACEZABOFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|