About 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole
4-methyl-2-phenyl-2,3-dihydro-1H-imidazole (PubChem CID 70449974) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole |
| PubChem CID | 70449974 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole |
| SMILES | CC1=CNC(c2ccccc2)N1 |
| InChI | InChI=1S/C10H12N2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7,10-12H,1H3 |
| InChIKey | LWMSQHDQYMVWST-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole?
The IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole (CID 70449974) is 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole.
What is the SMILES notation for 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole?
The canonical SMILES for 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole is CC1=CNC(c2ccccc2)N1.
What is the InChIKey of 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole?
The InChIKey is LWMSQHDQYMVWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7,10-12H,1H3.
What are the key properties of 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole?
4-methyl-2-phenyl-2,3-dihydro-1H-imidazole has a molecular weight of 160.22 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole is sourced from PubChem (CID 70449974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).