C10H12N2 — CID 70449974
4-methyl-2-phenyl-2,3-dihydro-1H-imidazole (PubChem CID 70449974) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole.
| Compound Name | 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 70449974 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-methyl-2-phenyl-2,3-dihydro-1H-imidazole |
| SMILES | CC1=CNC(c2ccccc2)N1 |
| InChI | InChI=1S/C10H12N2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7,10-12H,1H3 |
| InChIKey | LWMSQHDQYMVWST-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |