C16H20ClNO — CID 63549324
(5-chloro-3-methyl-1-benzofuran-2-yl)-cyclohexylmethanamine (PubChem CID 63549324) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is (5-chloro-3-methyl-1-benzofuran-2-yl)-cyclohexylmethanamine.
| Compound Name | (5-chloro-3-methyl-1-benzofuran-2-yl)-cyclohexylmethanamine |
|---|---|
| PubChem CID | 63549324 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (5-chloro-3-methyl-1-benzofuran-2-yl)-cyclohexylmethanamine |
| SMILES | Cc1c(C(N)C2CCCCC2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClNO/c1-10-13-9-12(17)7-8-14(13)19-16(10)15(18)11-5-3-2-4-6-11/h7-9,11,15H,2-6,18H2,1H3 |
| InChIKey | PLHFRUOUZAOKEA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |