C17H20INO — CID 63550729
N-[[4-(2-iodophenoxy)-2-methylphenyl]methyl]propan-1-amine (PubChem CID 63550729) has the molecular formula C17H20INO and a molecular weight of 381.26 g/mol. Its IUPAC name is N-[[4-(2-iodophenoxy)-2-methylphenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(2-iodophenoxy)-2-methylphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63550729 |
| Molecular Formula | C17H20INO |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[[4-(2-iodophenoxy)-2-methylphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Oc2ccccc2I)cc1C |
| InChI | InChI=1S/C17H20INO/c1-3-10-19-12-14-8-9-15(11-13(14)2)20-17-7-5-4-6-16(17)18/h4-9,11,19H,3,10,12H2,1-2H3 |
| InChIKey | YNSOWYXXAJMSBI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|