C18H24N2O — CID 81254541
N-[[4-(3,4-dimethylphenoxy)-6-methyl-3-pyridinyl]methyl]propan-1-amine (PubChem CID 81254541) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[[4-(3,4-dimethylphenoxy)-6-methyl-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(3,4-dimethylphenoxy)-6-methyl-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81254541 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[[4-(3,4-dimethylphenoxy)-6-methyl-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C)cc1Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H24N2O/c1-5-8-19-11-16-12-20-15(4)10-18(16)21-17-7-6-13(2)14(3)9-17/h6-7,9-10,12,19H,5,8,11H2,1-4H3 |
| InChIKey | YWGJTKWVDHVWTN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|