C15H26N2O — CID 81254555
N-[[6-methyl-4-(3-methylbutoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 81254555) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N-[[6-methyl-4-(3-methylbutoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-methyl-4-(3-methylbutoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81254555 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-[[6-methyl-4-(3-methylbutoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C)cc1OCCC(C)C |
| InChI | InChI=1S/C15H26N2O/c1-5-7-16-10-14-11-17-13(4)9-15(14)18-8-6-12(2)3/h9,11-12,16H,5-8,10H2,1-4H3 |
| InChIKey | CJDXIUQXSFJTMB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|