C14H21F3N2O — CID 82792176
N-[[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 82792176) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is N-[[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82792176 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C)cc1OCCCC(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O/c1-3-6-18-9-12-10-19-11(2)8-13(12)20-7-4-5-14(15,16)17/h8,10,18H,3-7,9H2,1-2H3 |
| InChIKey | UZPLWBSBOUEDKE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|