C12H17F3N2O — CID 82792518
N-methyl-1-[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methanamine (PubChem CID 82792518) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is N-methyl-1-[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methanamine.
| Compound Name | N-methyl-1-[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 82792518 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-methyl-1-[6-methyl-4-(4,4,4-trifluorobutoxy)-3-pyridinyl]methanamine |
| SMILES | CNCc1cnc(C)cc1OCCCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-9-6-11(10(7-16-2)8-17-9)18-5-3-4-12(13,14)15/h6,8,16H,3-5,7H2,1-2H3 |
| InChIKey | AERKDWOQVQXQFD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|