C14H22N2O — CID 81250972
1-[4-(cyclopentylmethoxy)-6-methyl-3-pyridinyl]-N-methylmethanamine (PubChem CID 81250972) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[4-(cyclopentylmethoxy)-6-methyl-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[4-(cyclopentylmethoxy)-6-methyl-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 81250972 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-[4-(cyclopentylmethoxy)-6-methyl-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(C)cc1OCC1CCCC1 |
| InChI | InChI=1S/C14H22N2O/c1-11-7-14(13(8-15-2)9-16-11)17-10-12-5-3-4-6-12/h7,9,12,15H,3-6,8,10H2,1-2H3 |
| InChIKey | SSCDSLZBPGKPNJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |