C17H27BrN2 — CID 63551604
N-[[4-bromo-2-(2,4-dimethylpiperidin-1-yl)phenyl]methyl]propan-1-amine (PubChem CID 63551604) has the molecular formula C17H27BrN2 and a molecular weight of 339.32 g/mol. Its IUPAC name is N-[[4-bromo-2-(2,4-dimethylpiperidin-1-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-(2,4-dimethylpiperidin-1-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63551604 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[[4-bromo-2-(2,4-dimethylpiperidin-1-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1N1CCC(C)CC1C |
| InChI | InChI=1S/C17H27BrN2/c1-4-8-19-12-15-5-6-16(18)11-17(15)20-9-7-13(2)10-14(20)3/h5-6,11,13-14,19H,4,7-10,12H2,1-3H3 |
| InChIKey | VZRRZYWLSQSORE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|