C17H21BrN2S — CID 43280572
N-[[4-bromo-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methyl]propan-1-amine (PubChem CID 43280572) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is N-[[4-bromo-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43280572 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[[4-bromo-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H21BrN2S/c1-2-7-19-11-13-3-4-15(18)10-16(13)20-8-5-17-14(12-20)6-9-21-17/h3-4,6,9-10,19H,2,5,7-8,11-12H2,1H3 |
| InChIKey | JNTLCTADACGNJO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|