C12H15FN2O3 — CID 63557017
N-(2-amino-4-fluorophenyl)-2-(oxolan-3-yloxy)acetamide (PubChem CID 63557017) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-(oxolan-3-yloxy)acetamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-(oxolan-3-yloxy)acetamide |
|---|---|
| PubChem CID | 63557017 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-(oxolan-3-yloxy)acetamide |
| SMILES | Nc1cc(F)ccc1NC(=O)COC1CCOC1 |
| InChI | InChI=1S/C12H15FN2O3/c13-8-1-2-11(10(14)5-8)15-12(16)7-18-9-3-4-17-6-9/h1-2,5,9H,3-4,6-7,14H2,(H,15,16) |
| InChIKey | QMJWJVCIDLPUTI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|