C12H14Cl2N2O3 — CID 63556430
N-(2-amino-4,6-dichlorophenyl)-2-(oxolan-3-yloxy)acetamide (PubChem CID 63556430) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(oxolan-3-yloxy)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(oxolan-3-yloxy)acetamide |
|---|---|
| PubChem CID | 63556430 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(oxolan-3-yloxy)acetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)COC1CCOC1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c13-7-3-9(14)12(10(15)4-7)16-11(17)6-19-8-1-2-18-5-8/h3-4,8H,1-2,5-6,15H2,(H,16,17) |
| InChIKey | KXCOFGGHATZTDL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|