C12H12Cl2O3 — CID 55225720
1-(2,5-dichlorophenyl)-2-(oxolan-3-yloxy)ethanone (PubChem CID 55225720) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(oxolan-3-yloxy)ethanone.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(oxolan-3-yloxy)ethanone |
|---|---|
| PubChem CID | 55225720 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(oxolan-3-yloxy)ethanone |
| SMILES | O=C(COC1CCOC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2O3/c13-8-1-2-11(14)10(5-8)12(15)7-17-9-3-4-16-6-9/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | HTSRCZFNESIWOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |